C27H24FNO4 — CID 170153419
4-[4-[2-(3,4-dimethylphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 170153419) has the molecular formula C27H24FNO4 and a molecular weight of 445.49 g/mol. Its IUPAC name is 4-[4-[2-(3,4-dimethylphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | 4-[4-[2-(3,4-dimethylphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 170153419 |
| Molecular Formula | C27H24FNO4 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 4-[4-[2-(3,4-dimethylphenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | Cc1ccc(C(=O)COc2ccc(N3C(=O)C4C5C=CC(C6CC56)C4C3=O)c(F)c2)cc1C |
| InChI | InChI=1S/C27H24FNO4/c1-13-3-4-15(9-14(13)2)23(30)12-33-16-5-8-22(21(28)10-16)29-26(31)24-17-6-7-18(20-11-19(17)20)25(24)27(29)32/h3-10,17-20,24-25H,11-12H2,1-2H3 |
| InChIKey | YRHDCNLCXGXSTN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|