C27H25NO6 — CID 169217178
(1R,2R,6S,7S,8S,10R)-4-[4-[2-(3,4-dimethoxyphenyl)-2-oxoethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 169217178) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is (1R,2R,6S,7S,8S,10R)-4-[4-[2-(3,4-dimethoxyphenyl)-2-oxoethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7S,8S,10R)-4-[4-[2-(3,4-dimethoxyphenyl)-2-oxoethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 169217178 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (1R,2R,6S,7S,8S,10R)-4-[4-[2-(3,4-dimethoxyphenyl)-2-oxoethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | COc1ccc(C(=O)COc2ccc(N3C(=O)[C@@H]4[C@@H]5C=C[C@@H]([C@H]6C[C@@H]56)[C@@H]4C3=O)cc2)cc1OC |
| InChI | InChI=1S/C27H25NO6/c1-32-22-10-3-14(11-23(22)33-2)21(29)13-34-16-6-4-15(5-7-16)28-26(30)24-17-8-9-18(20-12-19(17)20)25(24)27(28)31/h3-11,17-20,24-25H,12-13H2,1-2H3/t17-,18+,19+,20-,24-,25+ |
| InChIKey | GDDIMTQITLQOOQ-OEIBJXBFSA-N |
| XLogP | 3.52 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|