C24H20ClN3O5 — CID 169217001
(1R,2R,6S,7S,8S,10R)-4-[5-[2-(3-chloro-4-methoxyphenyl)-2-oxoethoxy]pyrimidin-2-yl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 169217001) has the molecular formula C24H20ClN3O5 and a molecular weight of 465.89 g/mol. Its IUPAC name is (1R,2R,6S,7S,8S,10R)-4-[5-[2-(3-chloro-4-methoxyphenyl)-2-oxoethoxy]pyrimidin-2-yl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7S,8S,10R)-4-[5-[2-(3-chloro-4-methoxyphenyl)-2-oxoethoxy]pyrimidin-2-yl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 169217001 |
| Molecular Formula | C24H20ClN3O5 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (1R,2R,6S,7S,8S,10R)-4-[5-[2-(3-chloro-4-methoxyphenyl)-2-oxoethoxy]pyrimidin-2-yl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | COc1ccc(C(=O)COc2cnc(N3C(=O)[C@@H]4[C@@H]5C=C[C@@H]([C@H]6C[C@@H]56)[C@@H]4C3=O)nc2)cc1Cl |
| InChI | InChI=1S/C24H20ClN3O5/c1-32-19-5-2-11(6-17(19)25)18(29)10-33-12-8-26-24(27-9-12)28-22(30)20-13-3-4-14(16-7-15(13)16)21(20)23(28)31/h2-6,8-9,13-16,20-21H,7,10H2,1H3/t13-,14+,15+,16-,20-,21+ |
| InChIKey | QDRMKNZZWALZDG-ZXSRWRPZSA-N |
| XLogP | 2.96 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|