C25H18ClF2NO4 — CID 169217022
(7R)-4-[4-[2-(3-chloro-4-fluorophenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 169217022) has the molecular formula C25H18ClF2NO4 and a molecular weight of 469.87 g/mol. Its IUPAC name is (7R)-4-[4-[2-(3-chloro-4-fluorophenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (7R)-4-[4-[2-(3-chloro-4-fluorophenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 169217022 |
| Molecular Formula | C25H18ClF2NO4 |
| Molecular Weight | 469.87 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (7R)-4-[4-[2-(3-chloro-4-fluorophenyl)-2-oxoethoxy]-2-fluorophenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C(COc1ccc(N2C(=O)C3C4C=C[C@H](C5CC45)C3C2=O)c(F)c1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C25H18ClF2NO4/c26-17-7-11(1-5-18(17)27)21(30)10-33-12-2-6-20(19(28)8-12)29-24(31)22-13-3-4-14(16-9-15(13)16)23(22)25(29)32/h1-8,13-16,22-23H,9-10H2/t13-,14?,15?,16?,22?,23?/m1/s1 |
| InChIKey | NWINRFWDPWYEPW-RUDKQXGHSA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.87 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|