C27H26N2O5 — CID 176618206
(2S,6R,7R,10S)-4-[4-[(2E)-2-methoxyimino-2-(4-methoxyphenyl)ethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 176618206) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is (2S,6R,7R,10S)-4-[4-[(2E)-2-methoxyimino-2-(4-methoxyphenyl)ethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (2S,6R,7R,10S)-4-[4-[(2E)-2-methoxyimino-2-(4-methoxyphenyl)ethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 176618206 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (2S,6R,7R,10S)-4-[4-[(2E)-2-methoxyimino-2-(4-methoxyphenyl)ethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | CO/N=C(/COc1ccc(N2C(=O)[C@@H]3[C@@H]4C=CC([C@H]5CC54)[C@@H]3C2=O)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H26N2O5/c1-32-17-7-3-15(4-8-17)23(28-33-2)14-34-18-9-5-16(6-10-18)29-26(30)24-19-11-12-20(22-13-21(19)22)25(24)27(29)31/h3-12,19-22,24-25H,13-14H2,1-2H3/b28-23-/t19-,20?,21?,22-,24-,25+/m1/s1 |
| InChIKey | FEILBSWRABNFNS-PTOOEQSDSA-N |
| XLogP | 3.68 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|