C26H25NO7 — CID 176618282
(1R,2R,7S,11S,12S)-11,12-dihydroxy-4-[4-[2-(4-methoxyphenyl)-2-oxoethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione (PubChem CID 176618282) has the molecular formula C26H25NO7 and a molecular weight of 463.49 g/mol. Its IUPAC name is (1R,2R,7S,11S,12S)-11,12-dihydroxy-4-[4-[2-(4-methoxyphenyl)-2-oxoethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione.
| Compound Name | (1R,2R,7S,11S,12S)-11,12-dihydroxy-4-[4-[2-(4-methoxyphenyl)-2-oxoethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
|---|---|
| PubChem CID | 176618282 |
| Molecular Formula | C26H25NO7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (1R,2R,7S,11S,12S)-11,12-dihydroxy-4-[4-[2-(4-methoxyphenyl)-2-oxoethoxy]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
| SMILES | COc1ccc(C(=O)COc2ccc(N3C(=O)C4[C@@H]5C6CC6[C@@H]([C@H](O)[C@H]5O)[C@H]4C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H25NO7/c1-33-14-6-2-12(3-7-14)18(28)11-34-15-8-4-13(5-9-15)27-25(31)21-19-16-10-17(16)20(22(21)26(27)32)24(30)23(19)29/h2-9,16-17,19-24,29-30H,10-11H2,1H3/t16?,17?,19-,20+,21-,22?,23+,24+/m1/s1 |
| InChIKey | WNCNNQUNHDXCQP-YNNGHFBTSA-N |
| XLogP | 1.68 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|