C10H7ClF3NO2 — CID 102474299
5-chloro-3-hydroxy-1-methyl-3-(trifluoromethyl)indol-2-one (PubChem CID 102474299) has the molecular formula C10H7ClF3NO2 and a molecular weight of 265.62 g/mol. Its IUPAC name is 5-chloro-3-hydroxy-1-methyl-3-(trifluoromethyl)indol-2-one.
| Compound Name | 5-chloro-3-hydroxy-1-methyl-3-(trifluoromethyl)indol-2-one |
|---|---|
| PubChem CID | 102474299 |
| Molecular Formula | C10H7ClF3NO2 |
| Molecular Weight | 265.62 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 5-chloro-3-hydroxy-1-methyl-3-(trifluoromethyl)indol-2-one |
| SMILES | CN1C(=O)C(O)(C(F)(F)F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H7ClF3NO2/c1-15-7-3-2-5(11)4-6(7)9(17,8(15)16)10(12,13)14/h2-4,17H,1H3 |
| InChIKey | LIUNOSASABVXJB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |