C12H12ClNO2 — CID 102579900
(3R)-5-chloro-3-hydroxy-1-methyl-3-prop-2-enylindol-2-one (PubChem CID 102579900) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is (3R)-5-chloro-3-hydroxy-1-methyl-3-prop-2-enylindol-2-one.
| Compound Name | (3R)-5-chloro-3-hydroxy-1-methyl-3-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 102579900 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (3R)-5-chloro-3-hydroxy-1-methyl-3-prop-2-enylindol-2-one |
| SMILES | C=CC[C@]1(O)C(=O)N(C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H12ClNO2/c1-3-6-12(16)9-7-8(13)4-5-10(9)14(2)11(12)15/h3-5,7,16H,1,6H2,2H3/t12-/m1/s1 |
| InChIKey | ZLIHREYWYOLGJN-GFCCVEGCSA-N |
| XLogP | 2.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|