C12H12ClF2NO — CID 125494618
(3R)-5-chloro-3-(2,2-difluoroethyl)-1,3-dimethylindol-2-one (PubChem CID 125494618) has the molecular formula C12H12ClF2NO and a molecular weight of 259.68 g/mol. Its IUPAC name is (3R)-5-chloro-3-(2,2-difluoroethyl)-1,3-dimethylindol-2-one.
| Compound Name | (3R)-5-chloro-3-(2,2-difluoroethyl)-1,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 125494618 |
| Molecular Formula | C12H12ClF2NO |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (3R)-5-chloro-3-(2,2-difluoroethyl)-1,3-dimethylindol-2-one |
| SMILES | CN1C(=O)[C@](C)(CC(F)F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H12ClF2NO/c1-12(6-10(14)15)8-5-7(13)3-4-9(8)16(2)11(12)17/h3-5,10H,6H2,1-2H3/t12-/m1/s1 |
| InChIKey | YSLGVSTYTBKOHF-GFCCVEGCSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |