C12H11F3N2O3 — CID 102357531
1,3-dimethyl-3-(nitromethyl)-5-(trifluoromethyl)indol-2-one (PubChem CID 102357531) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.23 g/mol. Its IUPAC name is 1,3-dimethyl-3-(nitromethyl)-5-(trifluoromethyl)indol-2-one.
| Compound Name | 1,3-dimethyl-3-(nitromethyl)-5-(trifluoromethyl)indol-2-one |
|---|---|
| PubChem CID | 102357531 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1,3-dimethyl-3-(nitromethyl)-5-(trifluoromethyl)indol-2-one |
| SMILES | CN1C(=O)C(C)(C[N+](=O)[O-])c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C12H11F3N2O3/c1-11(6-17(19)20)8-5-7(12(13,14)15)3-4-9(8)16(2)10(11)18/h3-5H,6H2,1-2H3 |
| InChIKey | CJGHTWNBKDVJJY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|