C13H14F3N — CID 11543250
1,3,3-trimethyl-2-methylidene-5-(trifluoromethyl)indole (PubChem CID 11543250) has the molecular formula C13H14F3N and a molecular weight of 241.26 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-methylidene-5-(trifluoromethyl)indole.
| Compound Name | 1,3,3-trimethyl-2-methylidene-5-(trifluoromethyl)indole |
|---|---|
| PubChem CID | 11543250 |
| Molecular Formula | C13H14F3N |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1,3,3-trimethyl-2-methylidene-5-(trifluoromethyl)indole |
| SMILES | C=C1N(C)c2ccc(C(F)(F)F)cc2C1(C)C |
| InChI | InChI=1S/C13H14F3N/c1-8-12(2,3)10-7-9(13(14,15)16)5-6-11(10)17(8)4/h5-7H,1H2,2-4H3 |
| InChIKey | PNNXTZJILDAJAQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |