C29H28ClF6IN2 — CID 162534589
(2E)-2-[(2Z,4E)-3-chloro-5-[1,3,3-trimethyl-5-(trifluoromethyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-1,3,3-trimethyl-5-(trifluoromethyl)indole iodide (PubChem CID 162534589) has the molecular formula C29H28ClF6IN2 and a molecular weight of 680.90 g/mol. Its IUPAC name is (2E)-2-[(2Z,4E)-3-chloro-5-[1,3,3-trimethyl-5-(trifluoromethyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-1,3,3-trimethyl-5-(trifluoromethyl)indole iodide.
| Compound Name | (2E)-2-[(2Z,4E)-3-chloro-5-[1,3,3-trimethyl-5-(trifluoromethyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-1,3,3-trimethyl-5-(trifluoromethyl)indole iodide |
|---|---|
| PubChem CID | 162534589 |
| Molecular Formula | C29H28ClF6IN2 |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.09 |
| IUPAC Name | (2E)-2-[(2Z,4E)-3-chloro-5-[1,3,3-trimethyl-5-(trifluoromethyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-1,3,3-trimethyl-5-(trifluoromethyl)indole iodide |
| SMILES | CN1/C(=C/C=C(Cl)/C=C/C2=[N+](C)c3ccc(C(F)(F)F)cc3C2(C)C)C(C)(C)c2cc(C(F)(F)F)ccc21.[I-] |
| InChI | InChI=1S/C29H28ClF6N2.HI/c1-26(2)20-15-17(28(31,32)33)7-11-22(20)37(5)24(26)13-9-19(30)10-14-25-27(3,4)21-16-18(29(34,35)36)8-12-23(21)38(25)6;/h7-16H,1-6H3;1H/q+1;/p-1 |
| InChIKey | PBAQVOFETJIBBO-UHFFFAOYSA-M |
| XLogP | 5.72 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|