C31H37IN2 — CID 174109944
1,3,3,5-tetramethyl-2-[2,3,4,5,6-pentadeuterio-7-(1,3,3,5-tetramethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole iodide (PubChem CID 174109944) has the molecular formula C31H37IN2 and a molecular weight of 569.59 g/mol. Its IUPAC name is 1,3,3,5-tetramethyl-2-[2,3,4,5,6-pentadeuterio-7-(1,3,3,5-tetramethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole iodide.
| Compound Name | 1,3,3,5-tetramethyl-2-[2,3,4,5,6-pentadeuterio-7-(1,3,3,5-tetramethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole iodide |
|---|---|
| PubChem CID | 174109944 |
| Molecular Formula | C31H37IN2 |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | 1,3,3,5-tetramethyl-2-[2,3,4,5,6-pentadeuterio-7-(1,3,3,5-tetramethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole iodide |
| SMILES | [2H]C(=CC1=[N+](C)c2ccc(C)cc2C1(C)C)C([2H])=C([2H])C([2H])=C([2H])C=C1N(C)c2ccc(C)cc2C1(C)C.[I-] |
| InChI | InChI=1S/C31H37N2.HI/c1-22-16-18-26-24(20-22)30(3,4)28(32(26)7)14-12-10-9-11-13-15-29-31(5,6)25-21-23(2)17-19-27(25)33(29)8;/h9-21H,1-8H3;1H/q+1;/p-1/i9D,10D,11D,12D,13D; |
| InChIKey | VMWAWIACEWMUCP-DXCCDNCZSA-M |
| XLogP | 4.29 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|