C29H29F6N2S2+ — CID 21176494
(2Z)-1,3,3-trimethyl-5-(trifluoromethylsulfanyl)-2-[(2E,4E)-5-[1,3,3-trimethyl-5-(trifluoromethylsulfanyl)indol-1-ium-2-yl]penta-2,4-dienylidene]indole (PubChem CID 21176494) has the molecular formula C29H29F6N2S2+ and a molecular weight of 583.69 g/mol. Its IUPAC name is (2Z)-1,3,3-trimethyl-5-(trifluoromethylsulfanyl)-2-[(2E,4E)-5-[1,3,3-trimethyl-5-(trifluoromethylsulfanyl)indol-1-ium-2-yl]penta-2,4-dienylidene]indole.
| Compound Name | (2Z)-1,3,3-trimethyl-5-(trifluoromethylsulfanyl)-2-[(2E,4E)-5-[1,3,3-trimethyl-5-(trifluoromethylsulfanyl)indol-1-ium-2-yl]penta-2,4-dienylidene]indole |
|---|---|
| PubChem CID | 21176494 |
| Molecular Formula | C29H29F6N2S2+ |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | (2Z)-1,3,3-trimethyl-5-(trifluoromethylsulfanyl)-2-[(2E,4E)-5-[1,3,3-trimethyl-5-(trifluoromethylsulfanyl)indol-1-ium-2-yl]penta-2,4-dienylidene]indole |
| SMILES | CN1/C(=C\C=C\C=C\C2=[N+](C)c3ccc(SC(F)(F)F)cc3C2(C)C)C(C)(C)c2cc(SC(F)(F)F)ccc21 |
| InChI | InChI=1S/C29H29F6N2S2/c1-26(2)20-16-18(38-28(30,31)32)12-14-22(20)36(5)24(26)10-8-7-9-11-25-27(3,4)21-17-19(39-29(33,34)35)13-15-23(21)37(25)6/h7-17H,1-6H3/q+1 |
| InChIKey | IGYLALPUXWKVAV-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|