C33H39N2O4+ — CID 59043276
2,2,5,7,7-pentamethyl-6-[5-(2,2,5,7,7-pentamethyl-[1,3]dioxolo[4,5-f]indol-5-ium-6-yl)penta-2,4-dienylidene]-[1,3]dioxolo[4,5-f]indole (PubChem CID 59043276) has the molecular formula C33H39N2O4+ and a molecular weight of 527.69 g/mol. Its IUPAC name is 2,2,5,7,7-pentamethyl-6-[5-(2,2,5,7,7-pentamethyl-[1,3]dioxolo[4,5-f]indol-5-ium-6-yl)penta-2,4-dienylidene]-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 2,2,5,7,7-pentamethyl-6-[5-(2,2,5,7,7-pentamethyl-[1,3]dioxolo[4,5-f]indol-5-ium-6-yl)penta-2,4-dienylidene]-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 59043276 |
| Molecular Formula | C33H39N2O4+ |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | 2,2,5,7,7-pentamethyl-6-[5-(2,2,5,7,7-pentamethyl-[1,3]dioxolo[4,5-f]indol-5-ium-6-yl)penta-2,4-dienylidene]-[1,3]dioxolo[4,5-f]indole |
| SMILES | CN1C(=CC=CC=CC2=[N+](C)c3cc4c(cc3C2(C)C)OC(C)(C)O4)C(C)(C)c2cc3c(cc21)OC(C)(C)O3 |
| InChI | InChI=1S/C33H39N2O4/c1-30(2)20-16-24-26(38-32(5,6)36-24)18-22(20)34(9)28(30)14-12-11-13-15-29-31(3,4)21-17-25-27(19-23(21)35(29)10)39-33(7,8)37-25/h11-19H,1-10H3/q+1 |
| InChIKey | PUFBBWHRWDWHEP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 43.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|