C29H35N2O2S+ — CID 18721208
(2E)-1,3,3,5-tetramethyl-2-[(2E,4E)-5-(1,3,3-trimethyl-5-methylsulfonylindol-1-ium-2-yl)penta-2,4-dienylidene]indole (PubChem CID 18721208) has the molecular formula C29H35N2O2S+ and a molecular weight of 475.68 g/mol. Its IUPAC name is (2E)-1,3,3,5-tetramethyl-2-[(2E,4E)-5-(1,3,3-trimethyl-5-methylsulfonylindol-1-ium-2-yl)penta-2,4-dienylidene]indole.
| Compound Name | (2E)-1,3,3,5-tetramethyl-2-[(2E,4E)-5-(1,3,3-trimethyl-5-methylsulfonylindol-1-ium-2-yl)penta-2,4-dienylidene]indole |
|---|---|
| PubChem CID | 18721208 |
| Molecular Formula | C29H35N2O2S+ |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (2E)-1,3,3,5-tetramethyl-2-[(2E,4E)-5-(1,3,3-trimethyl-5-methylsulfonylindol-1-ium-2-yl)penta-2,4-dienylidene]indole |
| SMILES | Cc1ccc2c(c1)C(C)(C)/C(=C\C=C\C=C\C1=[N+](C)c3ccc(S(C)(=O)=O)cc3C1(C)C)N2C |
| InChI | InChI=1S/C29H35N2O2S/c1-20-14-16-24-22(18-20)28(2,3)26(30(24)6)12-10-9-11-13-27-29(4,5)23-19-21(34(8,32)33)15-17-25(23)31(27)7/h9-19H,1-8H3/q+1 |
| InChIKey | RVNIBFQUSDGSFB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|