C30H35NO2S — CID 59891684
(2E)-1,3,3-trimethyl-5-methylsulfonyl-2-[(2E,4E)-5-(1,1,3,6-tetramethylinden-2-yl)penta-2,4-dienylidene]indole (PubChem CID 59891684) has the molecular formula C30H35NO2S and a molecular weight of 473.68 g/mol. Its IUPAC name is (2E)-1,3,3-trimethyl-5-methylsulfonyl-2-[(2E,4E)-5-(1,1,3,6-tetramethylinden-2-yl)penta-2,4-dienylidene]indole.
| Compound Name | (2E)-1,3,3-trimethyl-5-methylsulfonyl-2-[(2E,4E)-5-(1,1,3,6-tetramethylinden-2-yl)penta-2,4-dienylidene]indole |
|---|---|
| PubChem CID | 59891684 |
| Molecular Formula | C30H35NO2S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (2E)-1,3,3-trimethyl-5-methylsulfonyl-2-[(2E,4E)-5-(1,1,3,6-tetramethylinden-2-yl)penta-2,4-dienylidene]indole |
| SMILES | CC1=C(/C=C/C=C/C=C2/N(C)c3ccc(S(C)(=O)=O)cc3C2(C)C)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C30H35NO2S/c1-20-14-16-23-21(2)24(29(3,4)25(23)18-20)12-10-9-11-13-28-30(5,6)26-19-22(34(8,32)33)15-17-27(26)31(28)7/h9-19H,1-8H3/b11-9+,12-10+,28-13+ |
| InChIKey | VKDGUNPVTIGNCS-DHDGYVMASA-N |
| XLogP | 6.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|