C35H41Cl2N2+ — CID 178091496
(2E)-5-chloro-2-[(2Z)-2-[5-[(E)-2-(6-chloro-1,1,3-trimethylinden-2-yl)ethenyl]-1,1,4-trimethyl-2,6-dihydropyridin-1-ium-3-ylidene]ethylidene]-1,3,3-trimethylindole (PubChem CID 178091496) has the molecular formula C35H41Cl2N2+ and a molecular weight of 560.63 g/mol. Its IUPAC name is (2E)-5-chloro-2-[(2Z)-2-[5-[(E)-2-(6-chloro-1,1,3-trimethylinden-2-yl)ethenyl]-1,1,4-trimethyl-2,6-dihydropyridin-1-ium-3-ylidene]ethylidene]-1,3,3-trimethylindole.
| Compound Name | (2E)-5-chloro-2-[(2Z)-2-[5-[(E)-2-(6-chloro-1,1,3-trimethylinden-2-yl)ethenyl]-1,1,4-trimethyl-2,6-dihydropyridin-1-ium-3-ylidene]ethylidene]-1,3,3-trimethylindole |
|---|---|
| PubChem CID | 178091496 |
| Molecular Formula | C35H41Cl2N2+ |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | (2E)-5-chloro-2-[(2Z)-2-[5-[(E)-2-(6-chloro-1,1,3-trimethylinden-2-yl)ethenyl]-1,1,4-trimethyl-2,6-dihydropyridin-1-ium-3-ylidene]ethylidene]-1,3,3-trimethylindole |
| SMILES | CC1=C(/C=C/C2=C(C)c3ccc(Cl)cc3C2(C)C)C[N+](C)(C)C/C1=C\C=C1\N(C)c2ccc(Cl)cc2C1(C)C |
| InChI | InChI=1S/C35H41Cl2N2/c1-22-24(10-15-29-23(2)28-14-12-26(36)18-30(28)34(29,3)4)20-39(8,9)21-25(22)11-17-33-35(5,6)31-19-27(37)13-16-32(31)38(33)7/h10-19H,20-21H2,1-9H3/q+1/b15-10+,25-11+,33-17+ |
| InChIKey | PUWSLWCWVHYDBW-KTQSPGOGSA-N |
| XLogP | 9.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|