C36H41NO4 — CID 59878162
methyl 2-[2-[(1E,3E,5E,7E)-7-[1-(2-methoxy-2-oxoethyl)-3,3,5-trimethylindol-2-ylidene]hepta-1,3,5-trienyl]-3,3,5-trimethylinden-1-yl]acetate (PubChem CID 59878162) has the molecular formula C36H41NO4 and a molecular weight of 551.73 g/mol. Its IUPAC name is methyl 2-[2-[(1E,3E,5E,7E)-7-[1-(2-methoxy-2-oxoethyl)-3,3,5-trimethylindol-2-ylidene]hepta-1,3,5-trienyl]-3,3,5-trimethylinden-1-yl]acetate.
| Compound Name | methyl 2-[2-[(1E,3E,5E,7E)-7-[1-(2-methoxy-2-oxoethyl)-3,3,5-trimethylindol-2-ylidene]hepta-1,3,5-trienyl]-3,3,5-trimethylinden-1-yl]acetate |
|---|---|
| PubChem CID | 59878162 |
| Molecular Formula | C36H41NO4 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | methyl 2-[2-[(1E,3E,5E,7E)-7-[1-(2-methoxy-2-oxoethyl)-3,3,5-trimethylindol-2-ylidene]hepta-1,3,5-trienyl]-3,3,5-trimethylinden-1-yl]acetate |
| SMILES | COC(=O)CC1=C(/C=C/C=C/C=C/C=C2/N(CC(=O)OC)c3ccc(C)cc3C2(C)C)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C36H41NO4/c1-24-16-18-26-27(22-33(38)40-7)28(35(3,4)29(26)20-24)14-12-10-9-11-13-15-32-36(5,6)30-21-25(2)17-19-31(30)37(32)23-34(39)41-8/h9-21H,22-23H2,1-8H3/b10-9+,13-11+,14-12+,32-15+ |
| InChIKey | FSXNNBWNLOBAKX-MRASJKJHSA-N |
| XLogP | 7.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|