C58H47NO4 — CID 59878157
naphthalen-1-yl 2-[2-[(1E,3E,5E)-5-[1,1-dimethyl-3-(2-naphthalen-1-yloxy-2-oxoethyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylcyclopenta[a]naphthalen-3-yl]acetate (PubChem CID 59878157) has the molecular formula C58H47NO4 and a molecular weight of 822.02 g/mol. Its IUPAC name is naphthalen-1-yl 2-[2-[(1E,3E,5E)-5-[1,1-dimethyl-3-(2-naphthalen-1-yloxy-2-oxoethyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylcyclopenta[a]naphthalen-3-yl]acetate.
| Compound Name | naphthalen-1-yl 2-[2-[(1E,3E,5E)-5-[1,1-dimethyl-3-(2-naphthalen-1-yloxy-2-oxoethyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylcyclopenta[a]naphthalen-3-yl]acetate |
|---|---|
| PubChem CID | 59878157 |
| Molecular Formula | C58H47NO4 |
| Molecular Weight | 822.02 g/mol |
| Exact Mass | 821.35 |
| IUPAC Name | naphthalen-1-yl 2-[2-[(1E,3E,5E)-5-[1,1-dimethyl-3-(2-naphthalen-1-yloxy-2-oxoethyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1,1-dimethylcyclopenta[a]naphthalen-3-yl]acetate |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CC(=O)Oc3cccc4ccccc34)c3ccc4ccccc4c3C2(C)C)=C(CC(=O)Oc2cccc3ccccc23)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C58H47NO4/c1-57(2)48(47(46-34-32-40-20-10-14-26-44(40)55(46)57)36-53(60)62-50-29-16-22-38-18-8-12-24-42(38)50)28-6-5-7-31-52-58(3,4)56-45-27-15-11-21-41(45)33-35-49(56)59(52)37-54(61)63-51-30-17-23-39-19-9-13-25-43(39)51/h5-35H,36-37H2,1-4H3/b7-5+,28-6+,52-31+ |
| InChIKey | BNBQLTXZKXELJX-FVPCFXRNSA-N |
| XLogP | 13.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.02 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|