C31H43NO7S2 — CID 174186307
10-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]-3-propan-2-yldeca-4,6,8-triene-1-sulfonic acid;hydrate (PubChem CID 174186307) has the molecular formula C31H43NO7S2 and a molecular weight of 605.82 g/mol. Its IUPAC name is 10-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]-3-propan-2-yldeca-4,6,8-triene-1-sulfonic acid;hydrate.
| Compound Name | 10-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]-3-propan-2-yldeca-4,6,8-triene-1-sulfonic acid;hydrate |
|---|---|
| PubChem CID | 174186307 |
| Molecular Formula | C31H43NO7S2 |
| Molecular Weight | 605.82 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | 10-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]-3-propan-2-yldeca-4,6,8-triene-1-sulfonic acid;hydrate |
| SMILES | CC(C)C(C=CC=CC=CC=C1N(CCCCS(=O)(=O)O)c2ccc3ccccc3c2C1(C)C)CCS(=O)(=O)O.O |
| InChI | InChI=1S/C31H41NO6S2.H2O/c1-24(2)25(20-23-40(36,37)38)14-8-6-5-7-9-17-29-31(3,4)30-27-16-11-10-15-26(27)18-19-28(30)32(29)21-12-13-22-39(33,34)35;/h5-11,14-19,24-25H,12-13,20-23H2,1-4H3,(H,33,34,35)(H,36,37,38);1H2 |
| InChIKey | RYVVKKJXLZQFGI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.82 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|