C44H52N2O6S2 — CID 89333062
4-[[1-[(4E,6E,8E,10E)-10-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]-2-methyl-3-methylidenedeca-4,6,8-trien-2-yl]naphthalen-2-yl]amino]butane-1-sulfonic acid (PubChem CID 89333062) has the molecular formula C44H52N2O6S2 and a molecular weight of 769.04 g/mol. Its IUPAC name is 4-[[1-[(4E,6E,8E,10E)-10-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]-2-methyl-3-methylidenedeca-4,6,8-trien-2-yl]naphthalen-2-yl]amino]butane-1-sulfonic acid.
| Compound Name | 4-[[1-[(4E,6E,8E,10E)-10-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]-2-methyl-3-methylidenedeca-4,6,8-trien-2-yl]naphthalen-2-yl]amino]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 89333062 |
| Molecular Formula | C44H52N2O6S2 |
| Molecular Weight | 769.04 g/mol |
| Exact Mass | 768.33 |
| IUPAC Name | 4-[[1-[(4E,6E,8E,10E)-10-[1,1-dimethyl-3-(4-sulfobutyl)benzo[e]indol-2-ylidene]-2-methyl-3-methylidenedeca-4,6,8-trien-2-yl]naphthalen-2-yl]amino]butane-1-sulfonic acid |
| SMILES | C=C(/C=C/C=C/C=C/C=C1/N(CCCCS(=O)(=O)O)c2ccc3ccccc3c2C1(C)C)C(C)(C)c1c(NCCCCS(=O)(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C44H52N2O6S2/c1-33(43(2,3)41-36-22-13-11-20-34(36)25-27-38(41)45-29-15-17-31-53(47,48)49)19-9-7-6-8-10-24-40-44(4,5)42-37-23-14-12-21-35(37)26-28-39(42)46(40)30-16-18-32-54(50,51)52/h6-14,19-28,45H,1,15-18,29-32H2,2-5H3,(H,47,48,49)(H,50,51,52)/b7-6+,10-8+,19-9+,40-24+ |
| InChIKey | QBTXASMFLRASMI-GODHGXBNSA-N |
| XLogP | 9.93 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.04 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|