C41H46N2O2 — CID 145337998
3-[[1-[(4E,6E,8E,10E)-10-(1,1-dimethyl-3-propylbenzo[e]indol-2-ylidene)-2-methyldeca-4,6,8-trien-2-yl]naphthalen-2-yl]amino]propanoic acid (PubChem CID 145337998) has the molecular formula C41H46N2O2 and a molecular weight of 598.83 g/mol. Its IUPAC name is 3-[[1-[(4E,6E,8E,10E)-10-(1,1-dimethyl-3-propylbenzo[e]indol-2-ylidene)-2-methyldeca-4,6,8-trien-2-yl]naphthalen-2-yl]amino]propanoic acid.
| Compound Name | 3-[[1-[(4E,6E,8E,10E)-10-(1,1-dimethyl-3-propylbenzo[e]indol-2-ylidene)-2-methyldeca-4,6,8-trien-2-yl]naphthalen-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 145337998 |
| Molecular Formula | C41H46N2O2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | 3-[[1-[(4E,6E,8E,10E)-10-(1,1-dimethyl-3-propylbenzo[e]indol-2-ylidene)-2-methyldeca-4,6,8-trien-2-yl]naphthalen-2-yl]amino]propanoic acid |
| SMILES | CCCN1/C(=C/C=C/C=C/C=C/CC(C)(C)c2c(NCCC(=O)O)ccc3ccccc23)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C41H46N2O2/c1-6-29-43-35-25-23-31-18-13-15-20-33(31)39(35)41(4,5)36(43)21-11-9-7-8-10-16-27-40(2,3)38-32-19-14-12-17-30(32)22-24-34(38)42-28-26-37(44)45/h7-25,42H,6,26-29H2,1-5H3,(H,44,45)/b8-7+,11-9+,16-10+,36-21+ |
| InChIKey | VILPFDDDHDKCTC-PGDOGHRWSA-N |
| XLogP | 10.31 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|