C44H49N3O4 — CID 144847971
(2,5-dioxopyrrolidin-1-yl) 6-[[1-[(4E,6E,8E)-2-methyl-8-(1,1,3-trimethylbenzo[e]indol-2-ylidene)octa-4,6-dien-2-yl]naphthalen-2-yl]amino]hexanoate (PubChem CID 144847971) has the molecular formula C44H49N3O4 and a molecular weight of 683.89 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[1-[(4E,6E,8E)-2-methyl-8-(1,1,3-trimethylbenzo[e]indol-2-ylidene)octa-4,6-dien-2-yl]naphthalen-2-yl]amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[1-[(4E,6E,8E)-2-methyl-8-(1,1,3-trimethylbenzo[e]indol-2-ylidene)octa-4,6-dien-2-yl]naphthalen-2-yl]amino]hexanoate |
|---|---|
| PubChem CID | 144847971 |
| Molecular Formula | C44H49N3O4 |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.37 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[1-[(4E,6E,8E)-2-methyl-8-(1,1,3-trimethylbenzo[e]indol-2-ylidene)octa-4,6-dien-2-yl]naphthalen-2-yl]amino]hexanoate |
| SMILES | CN1/C(=C/C=C/C=C/CC(C)(C)c2c(NCCCCCC(=O)ON3C(=O)CCC3=O)ccc3ccccc23)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C44H49N3O4/c1-43(2,29-15-7-6-9-21-37-44(3,4)42-34-20-14-12-18-32(34)24-26-36(42)46(37)5)41-33-19-13-11-17-31(33)23-25-35(41)45-30-16-8-10-22-40(50)51-47-38(48)27-28-39(47)49/h6-7,9,11-15,17-21,23-26,45H,8,10,16,22,27-30H2,1-5H3/b9-6+,15-7+,37-21+ |
| InChIKey | XWJDVJMUMNDECF-WUGMUAFOSA-N |
| XLogP | 9.66 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|