C45H51N — CID 170393691
(2Z)-1,1-dimethyl-3-(6-methylhept-6-enyl)-2-[(2E,4E,6E)-9-methyl-8-methylidene-9-(2-methylnaphthalen-1-yl)deca-2,4,6-trienylidene]benzo[e]indole (PubChem CID 170393691) has the molecular formula C45H51N and a molecular weight of 605.91 g/mol. Its IUPAC name is (2Z)-1,1-dimethyl-3-(6-methylhept-6-enyl)-2-[(2E,4E,6E)-9-methyl-8-methylidene-9-(2-methylnaphthalen-1-yl)deca-2,4,6-trienylidene]benzo[e]indole.
| Compound Name | (2Z)-1,1-dimethyl-3-(6-methylhept-6-enyl)-2-[(2E,4E,6E)-9-methyl-8-methylidene-9-(2-methylnaphthalen-1-yl)deca-2,4,6-trienylidene]benzo[e]indole |
|---|---|
| PubChem CID | 170393691 |
| Molecular Formula | C45H51N |
| Molecular Weight | 605.91 g/mol |
| Exact Mass | 605.40 |
| IUPAC Name | (2Z)-1,1-dimethyl-3-(6-methylhept-6-enyl)-2-[(2E,4E,6E)-9-methyl-8-methylidene-9-(2-methylnaphthalen-1-yl)deca-2,4,6-trienylidene]benzo[e]indole |
| SMILES | C=C(C)CCCCCN1/C(=C\C=C\C=C\C=C\C(=C)C(C)(C)c2c(C)ccc3ccccc23)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C45H51N/c1-33(2)21-13-12-20-32-46-40-31-30-37-24-17-19-26-39(37)43(40)45(7,8)41(46)27-15-11-9-10-14-22-35(4)44(5,6)42-34(3)28-29-36-23-16-18-25-38(36)42/h9-11,14-19,22-31H,1,4,12-13,20-21,32H2,2-3,5-8H3/b10-9+,15-11+,22-14+,41-27- |
| InChIKey | YDSNMIAGBPYRNY-MBIPFVKBSA-N |
| XLogP | 12.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.91 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|