About 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one
3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one (PubChem CID 102140967) has the molecular formula C19H16F5NO3S
and a molecular weight of 433.40 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one.
Molecular Properties
| Compound Name | 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one |
| PubChem CID | 102140967 |
| Molecular Formula | C19H16F5NO3S |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one |
| SMILES | CN1C(=O)C(C)(CC(F)(F)S(=O)(=O)c2ccccc2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H16F5NO3S/c1-17(11-18(20,21)29(27,28)13-6-4-3-5-7-13)14-10-12(19(22,23)24)8-9-15(14)25(2)16(17)26/h3-10H,11H2,1-2H3 |
| InChIKey | WZCWFXXLZWXUOQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one?
The IUPAC name of 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one (CID 102140967) is 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one.
What is the SMILES notation for 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one?
The canonical SMILES for 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one is CN1C(=O)C(C)(CC(F)(F)S(=O)(=O)c2ccccc2)c2cc(C(F)(F)F)ccc21.
What is the InChIKey of 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one?
The InChIKey is WZCWFXXLZWXUOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F5NO3S/c1-17(11-18(20,21)29(27,28)13-6-4-3-5-7-13)14-10-12(19(22,23)24)8-9-15(14)25(2)16(17)26/h3-10H,11H2,1-2H3.
What are the key properties of 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one?
3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one has a molecular weight of 433.40 g/mol, XLogP of 4.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-1,3-dimethyl-5-(trifluoromethyl)indol-2-one is sourced from PubChem (CID 102140967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).