C15H16F2INO3 — CID 132820572
ethyl 2,2-difluoro-3-(5-iodo-1,3-dimethyl-2-oxoindol-3-yl)propanoate (PubChem CID 132820572) has the molecular formula C15H16F2INO3 and a molecular weight of 423.20 g/mol. Its IUPAC name is ethyl 2,2-difluoro-3-(5-iodo-1,3-dimethyl-2-oxoindol-3-yl)propanoate.
| Compound Name | ethyl 2,2-difluoro-3-(5-iodo-1,3-dimethyl-2-oxoindol-3-yl)propanoate |
|---|---|
| PubChem CID | 132820572 |
| Molecular Formula | C15H16F2INO3 |
| Molecular Weight | 423.20 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | ethyl 2,2-difluoro-3-(5-iodo-1,3-dimethyl-2-oxoindol-3-yl)propanoate |
| SMILES | CCOC(=O)C(F)(F)CC1(C)C(=O)N(C)c2ccc(I)cc21 |
| InChI | InChI=1S/C15H16F2INO3/c1-4-22-13(21)15(16,17)8-14(2)10-7-9(18)5-6-11(10)19(3)12(14)20/h5-7H,4,8H2,1-3H3 |
| InChIKey | SBDDAAADHCDFBF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|