C32H38F6I2N2O2 — CID 139193816
(3S)-1-ethyl-5-iodo-3-methyl-3-(3,3,3-trifluoro-2,2-dimethylpropyl)indol-2-one;(3R)-1-ethyl-5-iodo-3-methyl-3-(3,3,3-trifluoro-2,2-dimethylpropyl)indol-2-one (PubChem CID 139193816) has the molecular formula C32H38F6I2N2O2 and a molecular weight of 850.46 g/mol. Its IUPAC name is (3S)-1-ethyl-5-iodo-3-methyl-3-(3,3,3-trifluoro-2,2-dimethylpropyl)indol-2-one;(3R)-1-ethyl-5-iodo-3-methyl-3-(3,3,3-trifluoro-2,2-dimethylpropyl)indol-2-one.
| Compound Name | (3S)-1-ethyl-5-iodo-3-methyl-3-(3,3,3-trifluoro-2,2-dimethylpropyl)indol-2-one;(3R)-1-ethyl-5-iodo-3-methyl-3-(3,3,3-trifluoro-2,2-dimethylpropyl)indol-2-one |
|---|---|
| PubChem CID | 139193816 |
| Molecular Formula | C32H38F6I2N2O2 |
| Molecular Weight | 850.46 g/mol |
| Exact Mass | 850.09 |
| IUPAC Name | (3S)-1-ethyl-5-iodo-3-methyl-3-(3,3,3-trifluoro-2,2-dimethylpropyl)indol-2-one;(3R)-1-ethyl-5-iodo-3-methyl-3-(3,3,3-trifluoro-2,2-dimethylpropyl)indol-2-one |
| SMILES | CCN1C(=O)[C@@](C)(CC(C)(C)C(F)(F)F)c2cc(I)ccc21.CCN1C(=O)[C@](C)(CC(C)(C)C(F)(F)F)c2cc(I)ccc21 |
| InChI | InChI=1S/2C16H19F3INO/c2*1-5-21-12-7-6-10(20)8-11(12)15(4,13(21)22)9-14(2,3)16(17,18)19/h2*6-8H,5,9H2,1-4H3/t2*15-/m10/s1 |
| InChIKey | SXVYXIIDXZYEDT-ZWZQDMJTSA-N |
| XLogP | 9.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.46 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|