C16H20N2OS — CID 135045386
(5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)methyl thiocyanate (PubChem CID 135045386) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is (5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)methyl thiocyanate.
| Compound Name | (5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)methyl thiocyanate |
|---|---|
| PubChem CID | 135045386 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (5-tert-butyl-1,3-dimethyl-2-oxoindol-3-yl)methyl thiocyanate |
| SMILES | CN1C(=O)C(C)(CSC#N)c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C16H20N2OS/c1-15(2,3)11-6-7-13-12(8-11)16(4,9-20-10-17)14(19)18(13)5/h6-8H,9H2,1-5H3 |
| InChIKey | RNLJAJGMNQDJGU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|