C48H64N2 — CID 145186373
2-tert-butyl-7-[5-(7-tert-butyl-9,9,10-trimethylacridin-2-yl)-2,5-dimethylhexan-2-yl]-9,9,10-trimethylacridine (PubChem CID 145186373) has the molecular formula C48H64N2 and a molecular weight of 669.05 g/mol. Its IUPAC name is 2-tert-butyl-7-[5-(7-tert-butyl-9,9,10-trimethylacridin-2-yl)-2,5-dimethylhexan-2-yl]-9,9,10-trimethylacridine.
| Compound Name | 2-tert-butyl-7-[5-(7-tert-butyl-9,9,10-trimethylacridin-2-yl)-2,5-dimethylhexan-2-yl]-9,9,10-trimethylacridine |
|---|---|
| PubChem CID | 145186373 |
| Molecular Formula | C48H64N2 |
| Molecular Weight | 669.05 g/mol |
| Exact Mass | 668.51 |
| IUPAC Name | 2-tert-butyl-7-[5-(7-tert-butyl-9,9,10-trimethylacridin-2-yl)-2,5-dimethylhexan-2-yl]-9,9,10-trimethylacridine |
| SMILES | CN1c2ccc(C(C)(C)C)cc2C(C)(C)c2cc(C(C)(C)CCC(C)(C)c3ccc4c(c3)C(C)(C)c3cc(C(C)(C)C)ccc3N4C)ccc21 |
| InChI | InChI=1S/C48H64N2/c1-43(2,3)31-17-21-39-35(27-31)47(11,12)37-29-33(19-23-41(37)49(39)15)45(7,8)25-26-46(9,10)34-20-24-42-38(30-34)48(13,14)36-28-32(44(4,5)6)18-22-40(36)50(42)16/h17-24,27-30H,25-26H2,1-16H3 |
| InChIKey | MYDGSYNKWWTGAR-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.05 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |