C13H11N3OS — CID 135045619
(5-cyano-1,3-dimethyl-2-oxoindol-3-yl)methyl thiocyanate (PubChem CID 135045619) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is (5-cyano-1,3-dimethyl-2-oxoindol-3-yl)methyl thiocyanate.
| Compound Name | (5-cyano-1,3-dimethyl-2-oxoindol-3-yl)methyl thiocyanate |
|---|---|
| PubChem CID | 135045619 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | (5-cyano-1,3-dimethyl-2-oxoindol-3-yl)methyl thiocyanate |
| SMILES | CN1C(=O)C(C)(CSC#N)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C13H11N3OS/c1-13(7-18-8-15)10-5-9(6-14)3-4-11(10)16(2)12(13)17/h3-5H,7H2,1-2H3 |
| InChIKey | GGHFMYQWVWGCLJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|