C12H11N3O2 — CID 70656402
1,5-dimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile (PubChem CID 70656402) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1,5-dimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile.
| Compound Name | 1,5-dimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile |
|---|---|
| PubChem CID | 70656402 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1,5-dimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile |
| SMILES | CN1C(=O)CC(=O)N(C)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C12H11N3O2/c1-14-9-4-3-8(7-13)5-10(9)15(2)12(17)6-11(14)16/h3-5H,6H2,1-2H3 |
| InChIKey | YSRHIUGFSOJOCF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|