C13H12N4O — CID 117031604
1-(2-cyanoethyl)-4-methyl-3-oxo-2H-quinoxaline-6-carbonitrile (PubChem CID 117031604) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-4-methyl-3-oxo-2H-quinoxaline-6-carbonitrile.
| Compound Name | 1-(2-cyanoethyl)-4-methyl-3-oxo-2H-quinoxaline-6-carbonitrile |
|---|---|
| PubChem CID | 117031604 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-(2-cyanoethyl)-4-methyl-3-oxo-2H-quinoxaline-6-carbonitrile |
| SMILES | CN1C(=O)CN(CCC#N)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C13H12N4O/c1-16-12-7-10(8-15)3-4-11(12)17(6-2-5-14)9-13(16)18/h3-4,7H,2,6,9H2,1H3 |
| InChIKey | YYBQOVVZERMATM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 71.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |