C30H29NOSi — CID 122403973
1,3,5-trimethyl-3-(triphenylsilylmethyl)indol-2-one (PubChem CID 122403973) has the molecular formula C30H29NOSi and a molecular weight of 447.65 g/mol. Its IUPAC name is 1,3,5-trimethyl-3-(triphenylsilylmethyl)indol-2-one.
| Compound Name | 1,3,5-trimethyl-3-(triphenylsilylmethyl)indol-2-one |
|---|---|
| PubChem CID | 122403973 |
| Molecular Formula | C30H29NOSi |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1,3,5-trimethyl-3-(triphenylsilylmethyl)indol-2-one |
| SMILES | Cc1ccc2c(c1)C(C)(C[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N2C |
| InChI | InChI=1S/C30H29NOSi/c1-23-19-20-28-27(21-23)30(2,29(32)31(28)3)22-33(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-21H,22H2,1-3H3 |
| InChIKey | SJUSDUXDVGUNGN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|