2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid

C12H13NO3 — CID 167685372

IUPAC2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid
SMILESCN1C(=O)[C@](C)(CC(=O)O)c2ccccc21
InChIInChI=1S/C12H13NO3/c1-12(7-10(14)15)8-5-3-4-6-9(8)13(2)11(12)16/h3-6H,7H2,1-2H3,(H,14,15)/t12-/m1/s1
InChIKeyWDDTWYVIYBICKR-GFCCVEGCSA-N
MW219.24 g/mol
LogP1.40
Rot. Bonds2

About 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid

2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid (PubChem CID 167685372) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid
PubChem CID167685372
Molecular FormulaC12H13NO3
Molecular Weight219.24 g/mol
Exact Mass219.09
IUPAC Name2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid
SMILESCN1C(=O)[C@](C)(CC(=O)O)c2ccccc21
InChIInChI=1S/C12H13NO3/c1-12(7-10(14)15)8-5-3-4-6-9(8)13(2)11(12)16/h3-6H,7H2,1-2H3,(H,14,15)/t12-/m1/s1
InChIKeyWDDTWYVIYBICKR-GFCCVEGCSA-N
XLogP1.40
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 51.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid?
The IUPAC name of 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid (CID 167685372) is 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid.
What is the SMILES notation for 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid?
The canonical SMILES for 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid is CN1C(=O)[C@](C)(CC(=O)O)c2ccccc21.
What is the InChIKey of 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid?
The InChIKey is WDDTWYVIYBICKR-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H13NO3/c1-12(7-10(14)15)8-5-3-4-6-9(8)13(2)11(12)16/h3-6H,7H2,1-2H3,(H,14,15)/t12-/m1/s1.
What are the key properties of 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid?
2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid has a molecular weight of 219.24 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-1,3-dimethyl-2-oxoindol-3-yl]acetic acid is sourced from PubChem (CID 167685372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).