C12H15NO3S — CID 125478862
(3S)-1,3-dimethyl-3-(methylsulfonylmethyl)indol-2-one (PubChem CID 125478862) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is (3S)-1,3-dimethyl-3-(methylsulfonylmethyl)indol-2-one.
| Compound Name | (3S)-1,3-dimethyl-3-(methylsulfonylmethyl)indol-2-one |
|---|---|
| PubChem CID | 125478862 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (3S)-1,3-dimethyl-3-(methylsulfonylmethyl)indol-2-one |
| SMILES | CN1C(=O)[C@@](C)(CS(C)(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C12H15NO3S/c1-12(8-17(3,15)16)9-6-4-5-7-10(9)13(2)11(12)14/h4-7H,8H2,1-3H3/t12-/m0/s1 |
| InChIKey | KVQVDYHMPAIBOI-LBPRGKRZSA-N |
| XLogP | 0.97 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |