C12H13ClN2O2 — CID 117026330
1-(5-chloro-2-methylphenyl)-4-methylpiperazine-2,5-dione (PubChem CID 117026330) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-4-methylpiperazine-2,5-dione.
| Compound Name | 1-(5-chloro-2-methylphenyl)-4-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 117026330 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-4-methylpiperazine-2,5-dione |
| SMILES | Cc1ccc(Cl)cc1N1CC(=O)N(C)CC1=O |
| InChI | InChI=1S/C12H13ClN2O2/c1-8-3-4-9(13)5-10(8)15-7-11(16)14(2)6-12(15)17/h3-5H,6-7H2,1-2H3 |
| InChIKey | KOZWBLGJIAQTKJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |