C12H15ClN2S — CID 10198961
1-(5-chloro-2-methylphenyl)-3-methyl-1,3-diazinane-2-thione (PubChem CID 10198961) has the molecular formula C12H15ClN2S and a molecular weight of 254.79 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-3-methyl-1,3-diazinane-2-thione.
| Compound Name | 1-(5-chloro-2-methylphenyl)-3-methyl-1,3-diazinane-2-thione |
|---|---|
| PubChem CID | 10198961 |
| Molecular Formula | C12H15ClN2S |
| Molecular Weight | 254.79 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-3-methyl-1,3-diazinane-2-thione |
| SMILES | Cc1ccc(Cl)cc1N1CCCN(C)C1=S |
| InChI | InChI=1S/C12H15ClN2S/c1-9-4-5-10(13)8-11(9)15-7-3-6-14(2)12(15)16/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | CQCPEDPCASUQNU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|