C10H9Cl2N3O2 — CID 171984926
2-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazinane-3,5-dione (PubChem CID 171984926) has the molecular formula C10H9Cl2N3O2 and a molecular weight of 274.11 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazinane-3,5-dione.
| Compound Name | 2-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazinane-3,5-dione |
|---|---|
| PubChem CID | 171984926 |
| Molecular Formula | C10H9Cl2N3O2 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazinane-3,5-dione |
| SMILES | CN1C(=O)CNN(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C10H9Cl2N3O2/c1-14-9(16)5-13-15(10(14)17)8-3-2-6(11)4-7(8)12/h2-4,13H,5H2,1H3 |
| InChIKey | DZELVHYECIPBNS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |