C11H11Cl2NO — CID 1486799
1-(2,4-dichlorophenyl)-3,3-dimethylazetidin-2-one (PubChem CID 1486799) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3,3-dimethylazetidin-2-one.
| Compound Name | 1-(2,4-dichlorophenyl)-3,3-dimethylazetidin-2-one |
|---|---|
| PubChem CID | 1486799 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3,3-dimethylazetidin-2-one |
| SMILES | CC1(C)CN(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C11H11Cl2NO/c1-11(2)6-14(10(11)15)9-4-3-7(12)5-8(9)13/h3-5H,6H2,1-2H3 |
| InChIKey | VBZRCIQIMPKUJL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |