C10H20N2O2 — CID 176672470
1-butyl-3-methylimidazolidine-2,4-dione;ethane (PubChem CID 176672470) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-butyl-3-methylimidazolidine-2,4-dione;ethane.
| Compound Name | 1-butyl-3-methylimidazolidine-2,4-dione;ethane |
|---|---|
| PubChem CID | 176672470 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-butyl-3-methylimidazolidine-2,4-dione;ethane |
| SMILES | CC.CCCCN1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C8H14N2O2.C2H6/c1-3-4-5-10-6-7(11)9(2)8(10)12;1-2/h3-6H2,1-2H3;1-2H3 |
| InChIKey | WPZBRXGKKOTOST-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|