C16H29BrN2O2 — CID 105343167
1-(9-bromononyl)-4-propylpiperazine-2,5-dione (PubChem CID 105343167) has the molecular formula C16H29BrN2O2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 1-(9-bromononyl)-4-propylpiperazine-2,5-dione.
| Compound Name | 1-(9-bromononyl)-4-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 105343167 |
| Molecular Formula | C16H29BrN2O2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-(9-bromononyl)-4-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(CCCCCCCCCBr)CC1=O |
| InChI | InChI=1S/C16H29BrN2O2/c1-2-11-18-13-16(21)19(14-15(18)20)12-9-7-5-3-4-6-8-10-17/h2-14H2,1H3 |
| InChIKey | TZYVGMLNMCMWNH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|