C12H21BrN2O2 — CID 79936910
1-[2-(bromomethyl)butyl]-4-propylpiperazine-2,5-dione (PubChem CID 79936910) has the molecular formula C12H21BrN2O2 and a molecular weight of 305.22 g/mol. Its IUPAC name is 1-[2-(bromomethyl)butyl]-4-propylpiperazine-2,5-dione.
| Compound Name | 1-[2-(bromomethyl)butyl]-4-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 79936910 |
| Molecular Formula | C12H21BrN2O2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-[2-(bromomethyl)butyl]-4-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(CC(CC)CBr)CC1=O |
| InChI | InChI=1S/C12H21BrN2O2/c1-3-5-14-8-12(17)15(9-11(14)16)7-10(4-2)6-13/h10H,3-9H2,1-2H3 |
| InChIKey | PVYJPYNGDWNSJO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|