About 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione
1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione (PubChem CID 79942577) has the molecular formula C14H26N2O4
and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione |
| PubChem CID | 79942577 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(CCC(OCC)OCC)CC1=O |
| InChI | InChI=1S/C14H26N2O4/c1-4-8-15-10-13(18)16(11-12(15)17)9-7-14(19-5-2)20-6-3/h14H,4-11H2,1-3H3 |
| InChIKey | GXBJRTHDHMPJKC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione?
The IUPAC name of 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione (CID 79942577) is 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione.
What is the SMILES notation for 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione?
The canonical SMILES for 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione is CCCN1CC(=O)N(CCC(OCC)OCC)CC1=O.
What is the InChIKey of 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione?
The InChIKey is GXBJRTHDHMPJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O4/c1-4-8-15-10-13(18)16(11-12(15)17)9-7-14(19-5-2)20-6-3/h14H,4-11H2,1-3H3.
What are the key properties of 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione?
1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione has a molecular weight of 286.37 g/mol, XLogP of 0.86, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diethoxypropyl)-4-propylpiperazine-2,5-dione is sourced from PubChem (CID 79942577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).