About 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one
1-(3,3-diethoxypropyl)-1,3-diazinan-2-one (PubChem CID 69224786) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one |
| PubChem CID | 69224786 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one |
| SMILES | CCOC(CCN1CCCNC1=O)OCC |
| InChI | InChI=1S/C11H22N2O3/c1-3-15-10(16-4-2)6-9-13-8-5-7-12-11(13)14/h10H,3-9H2,1-2H3,(H,12,14) |
| InChIKey | YOLPWRDFJSJAEU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one?
The IUPAC name of 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one (CID 69224786) is 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one is CCOC(CCN1CCCNC1=O)OCC.
What is the InChIKey of 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one?
The InChIKey is YOLPWRDFJSJAEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-3-15-10(16-4-2)6-9-13-8-5-7-12-11(13)14/h10H,3-9H2,1-2H3,(H,12,14).
What are the key properties of 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one?
1-(3,3-diethoxypropyl)-1,3-diazinan-2-one has a molecular weight of 230.31 g/mol, XLogP of 1.19, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diethoxypropyl)-1,3-diazinan-2-one is sourced from PubChem (CID 69224786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).