C11H21NO3 — CID 63628099
1-(3,3-diethoxypropyl)pyrrolidin-2-one (PubChem CID 63628099) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)pyrrolidin-2-one.
| Compound Name | 1-(3,3-diethoxypropyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 63628099 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1-(3,3-diethoxypropyl)pyrrolidin-2-one |
| SMILES | CCOC(CCN1CCCC1=O)OCC |
| InChI | InChI=1S/C11H21NO3/c1-3-14-11(15-4-2)7-9-12-8-5-6-10(12)13/h11H,3-9H2,1-2H3 |
| InChIKey | CAQCIGYCXAEVDJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|