About methane;1-(2-methylpropyl)-1,3-diazinan-2-one
methane;1-(2-methylpropyl)-1,3-diazinan-2-one (PubChem CID 158406358) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is methane;1-(2-methylpropyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | methane;1-(2-methylpropyl)-1,3-diazinan-2-one |
| PubChem CID | 158406358 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | methane;1-(2-methylpropyl)-1,3-diazinan-2-one |
| SMILES | C.CC(C)CN1CCCNC1=O |
| InChI | InChI=1S/C8H16N2O.CH4/c1-7(2)6-10-5-3-4-9-8(10)11;/h7H,3-6H2,1-2H3,(H,9,11);1H4 |
| InChIKey | GYTAKZSXRGHDTA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;1-(2-methylpropyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-(2-methylpropyl)-1,3-diazinan-2-one?
The IUPAC name of methane;1-(2-methylpropyl)-1,3-diazinan-2-one (CID 158406358) is methane;1-(2-methylpropyl)-1,3-diazinan-2-one.
What is the SMILES notation for methane;1-(2-methylpropyl)-1,3-diazinan-2-one?
The canonical SMILES for methane;1-(2-methylpropyl)-1,3-diazinan-2-one is C.CC(C)CN1CCCNC1=O.
What is the InChIKey of methane;1-(2-methylpropyl)-1,3-diazinan-2-one?
The InChIKey is GYTAKZSXRGHDTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.CH4/c1-7(2)6-10-5-3-4-9-8(10)11;/h7H,3-6H2,1-2H3,(H,9,11);1H4.
What are the key properties of methane;1-(2-methylpropyl)-1,3-diazinan-2-one?
methane;1-(2-methylpropyl)-1,3-diazinan-2-one has a molecular weight of 172.27 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-(2-methylpropyl)-1,3-diazinan-2-one is sourced from PubChem (CID 158406358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).