C9H20N2O — CID 158406358
methane;1-(2-methylpropyl)-1,3-diazinan-2-one (PubChem CID 158406358) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is methane;1-(2-methylpropyl)-1,3-diazinan-2-one.
| Compound Name | methane;1-(2-methylpropyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 158406358 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | methane;1-(2-methylpropyl)-1,3-diazinan-2-one |
| SMILES | C.CC(C)CN1CCCNC1=O |
| InChI | InChI=1S/C8H16N2O.CH4/c1-7(2)6-10-5-3-4-9-8(10)11;/h7H,3-6H2,1-2H3,(H,9,11);1H4 |
| InChIKey | GYTAKZSXRGHDTA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |