C9H16N2O4 — CID 103157501
3-methoxy-4-(2-oxo-1,3-diazinan-1-yl)butanoic acid (PubChem CID 103157501) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-methoxy-4-(2-oxo-1,3-diazinan-1-yl)butanoic acid.
| Compound Name | 3-methoxy-4-(2-oxo-1,3-diazinan-1-yl)butanoic acid |
|---|---|
| PubChem CID | 103157501 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 3-methoxy-4-(2-oxo-1,3-diazinan-1-yl)butanoic acid |
| SMILES | COC(CC(=O)O)CN1CCCNC1=O |
| InChI | InChI=1S/C9H16N2O4/c1-15-7(5-8(12)13)6-11-4-2-3-10-9(11)14/h7H,2-6H2,1H3,(H,10,14)(H,12,13) |
| InChIKey | YEJQWGVONUQTNB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |