4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid

C12H20N2O3 — CID 79525514

IUPAC4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCC(CN2CCCNC2=O)CC1
InChIInChI=1S/C12H20N2O3/c15-11(16)10-4-2-9(3-5-10)8-14-7-1-6-13-12(14)17/h9-10H,1-8H2,(H,13,17)(H,15,16)
InChIKeyVDCBYJUDKWQZKO-UHFFFAOYSA-N
MW240.30 g/mol
LogP1.29
Rot. Bonds3

About 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid

4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid (PubChem CID 79525514) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid
PubChem CID79525514
Molecular FormulaC12H20N2O3
Molecular Weight240.30 g/mol
Exact Mass240.15
IUPAC Name4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid
SMILESO=C(O)C1CCC(CN2CCCNC2=O)CC1
InChIInChI=1S/C12H20N2O3/c15-11(16)10-4-2-9(3-5-10)8-14-7-1-6-13-12(14)17/h9-10H,1-8H2,(H,13,17)(H,15,16)
InChIKeyVDCBYJUDKWQZKO-UHFFFAOYSA-N
XLogP1.29
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.30
LogP ≤ 51.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid (CID 79525514) is 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid is O=C(O)C1CCC(CN2CCCNC2=O)CC1.
What is the InChIKey of 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid?
The InChIKey is VDCBYJUDKWQZKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3/c15-11(16)10-4-2-9(3-5-10)8-14-7-1-6-13-12(14)17/h9-10H,1-8H2,(H,13,17)(H,15,16).
What are the key properties of 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid?
4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid has a molecular weight of 240.30 g/mol, XLogP of 1.29, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-oxo-1,3-diazinan-1-yl)methyl]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 79525514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).