C16H22N2O4 — CID 23643230
4-[[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 23643230) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-[[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 23643230 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-[[(3,4-dioxo-2-pyrrolidin-1-ylcyclobuten-1-yl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(CNc2c(N3CCCC3)c(=O)c2=O)CC1 |
| InChI | InChI=1S/C16H22N2O4/c19-14-12(13(15(14)20)18-7-1-2-8-18)17-9-10-3-5-11(6-4-10)16(21)22/h10-11,17H,1-9H2,(H,21,22) |
| InChIKey | PMHCUHHILXZNMF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|